C20H28N2O4Si — CID 155649117
3-(3-but-3-enoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid (PubChem CID 155649117) has the molecular formula C20H28N2O4Si and a molecular weight of 388.54 g/mol. Its IUPAC name is 3-(3-but-3-enoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid.
| Compound Name | 3-(3-but-3-enoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155649117 |
| Molecular Formula | C20H28N2O4Si |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-(3-but-3-enoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylic acid |
| SMILES | C=CCCOc1cccc(-c2nn(COCC[Si](C)(C)C)cc2C(=O)O)c1 |
| InChI | InChI=1S/C20H28N2O4Si/c1-5-6-10-26-17-9-7-8-16(13-17)19-18(20(23)24)14-22(21-19)15-25-11-12-27(2,3)4/h5,7-9,13-14H,1,6,10-12,15H2,2-4H3,(H,23,24) |
| InChIKey | GUTQJSMRCAIBJQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|