C12H16N2O4 — CID 166074623
ethyl 2-formyl-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carboxylate (PubChem CID 166074623) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 2-formyl-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 2-formyl-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 166074623 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethyl 2-formyl-5-methyl-3-[[(2S)-oxetan-2-yl]methyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C=O)n1C[C@@H]1CCO1 |
| InChI | InChI=1S/C12H16N2O4/c1-3-17-12(16)11-8(2)13-10(7-15)14(11)6-9-4-5-18-9/h7,9H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | YBVWBVWNBQOXCS-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|