C16H24N4O5Si — CID 174186320
(E)-3-[2-[4-oxo-5-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyridazin-1-yl]ethoxy]prop-2-enoic acid (PubChem CID 174186320) has the molecular formula C16H24N4O5Si and a molecular weight of 380.48 g/mol. Its IUPAC name is (E)-3-[2-[4-oxo-5-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyridazin-1-yl]ethoxy]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[4-oxo-5-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyridazin-1-yl]ethoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 174186320 |
| Molecular Formula | C16H24N4O5Si |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (E)-3-[2-[4-oxo-5-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyridazin-1-yl]ethoxy]prop-2-enoic acid |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(cnn2CCO/C=C/C(=O)O)c1=O |
| InChI | InChI=1S/C16H24N4O5Si/c1-26(2,3)9-8-25-12-20-16(23)13-10-17-19(14(13)11-18-20)5-7-24-6-4-15(21)22/h4,6,10-11H,5,7-9,12H2,1-3H3,(H,21,22)/b6-4+ |
| InChIKey | ADRYRUGACTYVNC-GQCTYLIASA-N |
| XLogP | 1.52 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|