C27H32BrN3O3Si — CID 66602971
3-benzyl-2-bromo-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602971) has the molecular formula C27H32BrN3O3Si and a molecular weight of 554.56 g/mol. Its IUPAC name is 3-benzyl-2-bromo-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-benzyl-2-bromo-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602971 |
| Molecular Formula | C27H32BrN3O3Si |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 3-benzyl-2-bromo-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(c(Cc3ccccc3)c(Br)n2COCc2ccccc2)c1=O |
| InChI | InChI=1S/C27H32BrN3O3Si/c1-35(2,3)15-14-33-20-31-27(32)25-23(16-21-10-6-4-7-11-21)26(28)30(24(25)17-29-31)19-34-18-22-12-8-5-9-13-22/h4-13,17H,14-16,18-20H2,1-3H3 |
| InChIKey | HVFSKJMDRJQSFR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|