C27H33N3O4Si — CID 66612378
3-[(2-hydroxyphenyl)methyl]-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66612378) has the molecular formula C27H33N3O4Si and a molecular weight of 491.66 g/mol. Its IUPAC name is 3-[(2-hydroxyphenyl)methyl]-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-[(2-hydroxyphenyl)methyl]-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66612378 |
| Molecular Formula | C27H33N3O4Si |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 3-[(2-hydroxyphenyl)methyl]-1-(phenylmethoxymethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(c(Cc3ccccc3O)cn2COCc2ccccc2)c1=O |
| InChI | InChI=1S/C27H33N3O4Si/c1-35(2,3)14-13-33-20-30-27(32)26-23(15-22-11-7-8-12-25(22)31)17-29(24(26)16-28-30)19-34-18-21-9-5-4-6-10-21/h4-12,16-17,31H,13-15,18-20H2,1-3H3 |
| InChIKey | FOGJPDRCAMXZRM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|