C28H32F3N3O5Si — CID 150738905
methyl 4-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methoxy]benzoate (PubChem CID 150738905) has the molecular formula C28H32F3N3O5Si and a molecular weight of 575.66 g/mol. Its IUPAC name is methyl 4-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 150738905 |
| Molecular Formula | C28H32F3N3O5Si |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | methyl 4-[[2-[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]-1,3-dihydroisoindol-1-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC2c3ccccc3CN2c2cnn(COCC[Si](C)(C)C)c(=O)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H32F3N3O5Si/c1-37-27(36)19-9-11-21(12-10-19)39-17-24-22-8-6-5-7-20(22)16-33(24)23-15-32-34(18-38-13-14-40(2,3)4)26(35)25(23)28(29,30)31/h5-12,15,24H,13-14,16-18H2,1-4H3 |
| InChIKey | JTKOZHDEIXLQDB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|