C24H32F3N7O4Si — CID 153446866
2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]ethyl 4-(5-cyano-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 153446866) has the molecular formula C24H32F3N7O4Si and a molecular weight of 567.65 g/mol. Its IUPAC name is 2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]ethyl 4-(5-cyano-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | 2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]ethyl 4-(5-cyano-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153446866 |
| Molecular Formula | C24H32F3N7O4Si |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 2-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]ethyl 4-(5-cyano-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCn1ncc(NCCOC(=O)N2CCN(c3ccc(C#N)cn3)CC2)c(C(F)(F)F)c1=O |
| InChI | InChI=1S/C24H32F3N7O4Si/c1-39(2,3)13-12-37-17-34-22(35)21(24(25,26)27)19(16-31-34)29-6-11-38-23(36)33-9-7-32(8-10-33)20-5-4-18(14-28)15-30-20/h4-5,15-16,29H,6-13,17H2,1-3H3 |
| InChIKey | JPGNYLGLGXWJBN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|