C10H13F3N2O5Si — CID 174022523
3-[[methyl-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]silyl]methoxy]propanoic acid (PubChem CID 174022523) has the molecular formula C10H13F3N2O5Si and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[[methyl-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]silyl]methoxy]propanoic acid.
| Compound Name | 3-[[methyl-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]silyl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 174022523 |
| Molecular Formula | C10H13F3N2O5Si |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-[[methyl-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]silyl]methoxy]propanoic acid |
| SMILES | C[Si@@H](COCCC(=O)O)Oc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O5Si/c1-21(5-19-3-2-7(16)17)20-6-4-14-15-9(18)8(6)10(11,12)13/h4,21H,2-3,5H2,1H3,(H,15,18)(H,16,17)/t21-/m0/s1 |
| InChIKey | WSVPVVQOXVDQBC-NRFANRHFSA-N |
| XLogP | 0.55 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|