C25H31BrF4N4O3Si — CID 174054592
6-bromo-8-fluoro-2-[4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]isoquinolin-1-one (PubChem CID 174054592) has the molecular formula C25H31BrF4N4O3Si and a molecular weight of 619.53 g/mol. Its IUPAC name is 6-bromo-8-fluoro-2-[4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]isoquinolin-1-one.
| Compound Name | 6-bromo-8-fluoro-2-[4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 174054592 |
| Molecular Formula | C25H31BrF4N4O3Si |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 6-bromo-8-fluoro-2-[4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]isoquinolin-1-one |
| SMILES | CC(CCCn1ccc2cc(Br)cc(F)c2c1=O)Nc1cnn(COCC[Si](C)(C)C)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C25H31BrF4N4O3Si/c1-16(6-5-8-33-9-7-17-12-18(26)13-19(27)21(17)23(33)35)32-20-14-31-34(15-37-10-11-38(2,3)4)24(36)22(20)25(28,29)30/h7,9,12-14,16,32H,5-6,8,10-11,15H2,1-4H3 |
| InChIKey | KJAWGFZIITXYMQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|