C26H31BrF6N4O4Si — CID 174054372
6-bromo-2-[5-(difluoromethoxy)-4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]-7-fluoroisoquinolin-1-one (PubChem CID 174054372) has the molecular formula C26H31BrF6N4O4Si and a molecular weight of 685.54 g/mol. Its IUPAC name is 6-bromo-2-[5-(difluoromethoxy)-4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]-7-fluoroisoquinolin-1-one.
| Compound Name | 6-bromo-2-[5-(difluoromethoxy)-4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]-7-fluoroisoquinolin-1-one |
|---|---|
| PubChem CID | 174054372 |
| Molecular Formula | C26H31BrF6N4O4Si |
| Molecular Weight | 685.54 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 6-bromo-2-[5-(difluoromethoxy)-4-[[6-oxo-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]amino]pentyl]-7-fluoroisoquinolin-1-one |
| SMILES | C[Si](C)(C)CCOCn1ncc(NC(CCCn2ccc3cc(Br)c(F)cc3c2=O)COC(F)F)c(C(F)(F)F)c1=O |
| InChI | InChI=1S/C26H31BrF6N4O4Si/c1-42(2,3)10-9-40-15-37-24(39)22(26(31,32)33)21(13-34-37)35-17(14-41-25(29)30)5-4-7-36-8-6-16-11-19(27)20(28)12-18(16)23(36)38/h6,8,11-13,17,25,35H,4-5,7,9-10,14-15H2,1-3H3 |
| InChIKey | WKSHKTNOIZCJDQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|