C20H26ClN3O2Si — CID 171404399
2-[[3-[(1-chloroisoquinolin-6-yl)oxymethyl]-5-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171404399) has the molecular formula C20H26ClN3O2Si and a molecular weight of 403.99 g/mol. Its IUPAC name is 2-[[3-[(1-chloroisoquinolin-6-yl)oxymethyl]-5-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[(1-chloroisoquinolin-6-yl)oxymethyl]-5-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171404399 |
| Molecular Formula | C20H26ClN3O2Si |
| Molecular Weight | 403.99 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[[3-[(1-chloroisoquinolin-6-yl)oxymethyl]-5-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(COc2ccc3c(Cl)nccc3c2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26ClN3O2Si/c1-15-11-17(23-24(15)14-25-9-10-27(2,3)4)13-26-18-5-6-19-16(12-18)7-8-22-20(19)21/h5-8,11-12H,9-10,13-14H2,1-4H3 |
| InChIKey | AGZVTGGJUOGQEJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|