C25H30ClN5O2Si — CID 170614563
N-(6-chloro-3-pyridinyl)-6-[[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methoxy]isoquinolin-1-amine (PubChem CID 170614563) has the molecular formula C25H30ClN5O2Si and a molecular weight of 496.09 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-[[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methoxy]isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-[[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methoxy]isoquinolin-1-amine |
|---|---|
| PubChem CID | 170614563 |
| Molecular Formula | C25H30ClN5O2Si |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-[[5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methoxy]isoquinolin-1-amine |
| SMILES | Cc1c(COc2ccc3c(Nc4ccc(Cl)nc4)nccc3c2)cnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H30ClN5O2Si/c1-18-20(14-29-31(18)17-32-11-12-34(2,3)4)16-33-22-6-7-23-19(13-22)9-10-27-25(23)30-21-5-8-24(26)28-15-21/h5-10,13-15H,11-12,16-17H2,1-4H3,(H,27,30) |
| InChIKey | SFYBPCRJJZGXJC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|