C21H18ClN5O — CID 170614527
N-(6-chloro-3-pyridinyl)-6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethoxy)isoquinolin-1-amine (PubChem CID 170614527) has the molecular formula C21H18ClN5O and a molecular weight of 391.86 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethoxy)isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethoxy)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170614527 |
| Molecular Formula | C21H18ClN5O |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethoxy)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(OCc4cnn5c4CCC5)ccc23)cn1 |
| InChI | InChI=1S/C21H18ClN5O/c22-20-6-3-16(12-24-20)26-21-18-5-4-17(10-14(18)7-8-23-21)28-13-15-11-25-27-9-1-2-19(15)27/h3-8,10-12H,1-2,9,13H2,(H,23,26) |
| InChIKey | YZPNUECEBBTIAV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|