C16H13BrClN3O — CID 170436032
6-(2-bromoethoxy)-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine (PubChem CID 170436032) has the molecular formula C16H13BrClN3O and a molecular weight of 378.66 g/mol. Its IUPAC name is 6-(2-bromoethoxy)-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine.
| Compound Name | 6-(2-bromoethoxy)-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170436032 |
| Molecular Formula | C16H13BrClN3O |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 6-(2-bromoethoxy)-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(OCCBr)ccc23)cn1 |
| InChI | InChI=1S/C16H13BrClN3O/c17-6-8-22-13-2-3-14-11(9-13)5-7-19-16(14)21-12-1-4-15(18)20-10-12/h1-5,7,9-10H,6,8H2,(H,19,21) |
| InChIKey | NXOJRGIYQWONNN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|