C18H13ClN4OS — CID 170435872
N-(6-chloro-3-pyridinyl)-6-(1,2-thiazol-4-ylmethoxy)isoquinolin-1-amine (PubChem CID 170435872) has the molecular formula C18H13ClN4OS and a molecular weight of 368.85 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-(1,2-thiazol-4-ylmethoxy)isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-(1,2-thiazol-4-ylmethoxy)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170435872 |
| Molecular Formula | C18H13ClN4OS |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-(1,2-thiazol-4-ylmethoxy)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(OCc4cnsc4)ccc23)cn1 |
| InChI | InChI=1S/C18H13ClN4OS/c19-17-4-1-14(9-21-17)23-18-16-3-2-15(7-13(16)5-6-20-18)24-10-12-8-22-25-11-12/h1-9,11H,10H2,(H,20,23) |
| InChIKey | JVORKFYNMZSTSI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|