C19H18ClFN4O — CID 170435897
N-(6-chloro-3-pyridinyl)-6-[2-(3-fluoroazetidin-1-yl)ethoxy]isoquinolin-1-amine (PubChem CID 170435897) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-[2-(3-fluoroazetidin-1-yl)ethoxy]isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-[2-(3-fluoroazetidin-1-yl)ethoxy]isoquinolin-1-amine |
|---|---|
| PubChem CID | 170435897 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-[2-(3-fluoroazetidin-1-yl)ethoxy]isoquinolin-1-amine |
| SMILES | FC1CN(CCOc2ccc3c(Nc4ccc(Cl)nc4)nccc3c2)C1 |
| InChI | InChI=1S/C19H18ClFN4O/c20-18-4-1-15(10-23-18)24-19-17-3-2-16(9-13(17)5-6-22-19)26-8-7-25-11-14(21)12-25/h1-6,9-10,14H,7-8,11-12H2,(H,22,24) |
| InChIKey | UDMYDBYHEXBPBY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|