C18H14ClN5O — CID 170450356
N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-4-ylmethoxy)isoquinolin-1-amine (PubChem CID 170450356) has the molecular formula C18H14ClN5O and a molecular weight of 351.80 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-4-ylmethoxy)isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-4-ylmethoxy)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170450356 |
| Molecular Formula | C18H14ClN5O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-4-ylmethoxy)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(OCc4cn[nH]c4)ccc23)cn1 |
| InChI | InChI=1S/C18H14ClN5O/c19-17-4-1-14(10-21-17)24-18-16-3-2-15(7-13(16)5-6-20-18)25-11-12-8-22-23-9-12/h1-10H,11H2,(H,20,24)(H,22,23) |
| InChIKey | DFYZQTINLSRJIA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|