C18H13Cl2N5O — CID 170450367
6-[(5-chloro-1H-pyrazol-4-yl)methoxy]-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine (PubChem CID 170450367) has the molecular formula C18H13Cl2N5O and a molecular weight of 386.24 g/mol. Its IUPAC name is 6-[(5-chloro-1H-pyrazol-4-yl)methoxy]-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine.
| Compound Name | 6-[(5-chloro-1H-pyrazol-4-yl)methoxy]-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170450367 |
| Molecular Formula | C18H13Cl2N5O |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-[(5-chloro-1H-pyrazol-4-yl)methoxy]-N-(6-chloro-3-pyridinyl)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(OCc4cn[nH]c4Cl)ccc23)cn1 |
| InChI | InChI=1S/C18H13Cl2N5O/c19-16-4-1-13(9-22-16)24-18-15-3-2-14(7-11(15)5-6-21-18)26-10-12-8-23-25-17(12)20/h1-9H,10H2,(H,21,24)(H,23,25) |
| InChIKey | XMCDBMHFGDLJSF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|