C17H12ClN5 — CID 170450423
N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-5-yl)isoquinolin-1-amine (PubChem CID 170450423) has the molecular formula C17H12ClN5 and a molecular weight of 321.77 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-5-yl)isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-5-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 170450423 |
| Molecular Formula | C17H12ClN5 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-(1H-pyrazol-5-yl)isoquinolin-1-amine |
| SMILES | Clc1ccc(Nc2nccc3cc(-c4ccn[nH]4)ccc23)cn1 |
| InChI | InChI=1S/C17H12ClN5/c18-16-4-2-13(10-20-16)22-17-14-3-1-12(15-6-8-21-23-15)9-11(14)5-7-19-17/h1-10H,(H,19,22)(H,21,23) |
| InChIKey | XQNCASOTBNJHNZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|