C16H21BrN4OSSi — CID 162491542
2-[[3-bromo-6-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 162491542) has the molecular formula C16H21BrN4OSSi and a molecular weight of 425.43 g/mol. Its IUPAC name is 2-[[3-bromo-6-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-6-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162491542 |
| Molecular Formula | C16H21BrN4OSSi |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[[3-bromo-6-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nnc(-c2ccc3c(Br)cn(COCC[Si](C)(C)C)c3n2)s1 |
| InChI | InChI=1S/C16H21BrN4OSSi/c1-11-19-20-16(23-11)14-6-5-12-13(17)9-21(15(12)18-14)10-22-7-8-24(2,3)4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | ZCEHJAXENLSOHM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|