C10H17BrF2N2OSi — CID 176911692
2-[[2-bromo-4-(difluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 176911692) has the molecular formula C10H17BrF2N2OSi and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-[[2-bromo-4-(difluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-bromo-4-(difluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 176911692 |
| Molecular Formula | C10H17BrF2N2OSi |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-[[2-bromo-4-(difluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)F)nc1Br |
| InChI | InChI=1S/C10H17BrF2N2OSi/c1-17(2,3)5-4-16-7-15-6-8(9(12)13)14-10(15)11/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | ZBQVPOSQTMRTGN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|