C14H21BrN2O2Si — CID 159477768
2-trimethylsilylethyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (PubChem CID 159477768) has the molecular formula C14H21BrN2O2Si and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 159477768 |
| Molecular Formula | C14H21BrN2O2Si |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-trimethylsilylethyl 3-bromo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCc2ncc(Br)cc2C1 |
| InChI | InChI=1S/C14H21BrN2O2Si/c1-20(2,3)7-6-19-14(18)17-5-4-13-11(10-17)8-12(15)9-16-13/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | IODYFPRSJJRGGY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|