C13H20IN3O2Si — CID 131742323
7-iodo-1-(2-trimethylsilylethoxymethyl)-3,4-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 131742323) has the molecular formula C13H20IN3O2Si and a molecular weight of 405.31 g/mol. Its IUPAC name is 7-iodo-1-(2-trimethylsilylethoxymethyl)-3,4-dihydropyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-iodo-1-(2-trimethylsilylethoxymethyl)-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 131742323 |
| Molecular Formula | C13H20IN3O2Si |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 7-iodo-1-(2-trimethylsilylethoxymethyl)-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CNc2ncc(I)cc21 |
| InChI | InChI=1S/C13H20IN3O2Si/c1-20(2,3)5-4-19-9-17-11-6-10(14)7-15-13(11)16-8-12(17)18/h6-7H,4-5,8-9H2,1-3H3,(H,15,16) |
| InChIKey | RVUJOLURBVLBNF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|