About 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one
1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 146594866) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 146594866 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CCCOCN1C(=O)Cc2cccnc21 |
| InChI | InChI=1S/C11H14N2O2/c1-2-6-15-8-13-10(14)7-9-4-3-5-12-11(9)13/h3-5H,2,6-8H2,1H3 |
| InChIKey | HLAZGDBLUJIETJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one (CID 146594866) is 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one is CCCOCN1C(=O)Cc2cccnc21.
What is the InChIKey of 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one?
The InChIKey is HLAZGDBLUJIETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-2-6-15-8-13-10(14)7-9-4-3-5-12-11(9)13/h3-5H,2,6-8H2,1H3.
What are the key properties of 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one?
1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one has a molecular weight of 206.24 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propoxymethyl)-3H-pyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 146594866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).