C11H8N2O2 — CID 142017824
1-(furan-2-yl)-3H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 142017824) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 1-(furan-2-yl)-3H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 1-(furan-2-yl)-3H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 142017824 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(furan-2-yl)-3H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2cccnc2N1c1ccco1 |
| InChI | InChI=1S/C11H8N2O2/c14-9-7-8-3-1-5-12-11(8)13(9)10-4-2-6-15-10/h1-6H,7H2 |
| InChIKey | YBHCBBZYGLDYNT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |