C11H19N3O5Si — CID 166058271
methyl 5-nitro-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate (PubChem CID 166058271) has the molecular formula C11H19N3O5Si and a molecular weight of 301.38 g/mol. Its IUPAC name is methyl 5-nitro-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-nitro-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166058271 |
| Molecular Formula | C11H19N3O5Si |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 5-nitro-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(COCC[Si](C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N3O5Si/c1-18-11(15)9-7-12-13(10(9)14(16)17)8-19-5-6-20(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | RVSKDWBGNKKAOC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|