C31H26N2 — CID 141094204
1-ethyl-4-(4-phenylphenyl)-2-[(E)-2-(4-phenylphenyl)ethenyl]imidazole (PubChem CID 141094204) has the molecular formula C31H26N2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-ethyl-4-(4-phenylphenyl)-2-[(E)-2-(4-phenylphenyl)ethenyl]imidazole.
| Compound Name | 1-ethyl-4-(4-phenylphenyl)-2-[(E)-2-(4-phenylphenyl)ethenyl]imidazole |
|---|---|
| PubChem CID | 141094204 |
| Molecular Formula | C31H26N2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-ethyl-4-(4-phenylphenyl)-2-[(E)-2-(4-phenylphenyl)ethenyl]imidazole |
| SMILES | CCn1cc(-c2ccc(-c3ccccc3)cc2)nc1/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2/c1-2-33-23-30(29-20-18-28(19-21-29)26-11-7-4-8-12-26)32-31(33)22-15-24-13-16-27(17-14-24)25-9-5-3-6-10-25/h3-23H,2H2,1H3/b22-15+ |
| InChIKey | ZVHVEXNOIIMWNY-PXLXIMEGSA-N |
| XLogP | 8.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |