C30H28N2O5 — CID 76703821
4-[2-[2-[4-[4-(3-carboxypropoxy)phenyl]phenyl]ethenyl]-1-ethylimidazol-4-yl]benzoic acid (PubChem CID 76703821) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is 4-[2-[2-[4-[4-(3-carboxypropoxy)phenyl]phenyl]ethenyl]-1-ethylimidazol-4-yl]benzoic acid.
| Compound Name | 4-[2-[2-[4-[4-(3-carboxypropoxy)phenyl]phenyl]ethenyl]-1-ethylimidazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 76703821 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 4-[2-[2-[4-[4-(3-carboxypropoxy)phenyl]phenyl]ethenyl]-1-ethylimidazol-4-yl]benzoic acid |
| SMILES | CCn1cc(-c2ccc(C(=O)O)cc2)nc1C=Cc1ccc(-c2ccc(OCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-2-32-20-27(24-10-12-25(13-11-24)30(35)36)31-28(32)18-7-21-5-8-22(9-6-21)23-14-16-26(17-15-23)37-19-3-4-29(33)34/h5-18,20H,2-4,19H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | RZRAETWIKFDBHV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|