C30H28Cl2N2O4 — CID 58211836
4-[3-[3-[(E)-2-[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]ethenyl]-4-methoxyphenyl]phenoxy]butanoic acid (PubChem CID 58211836) has the molecular formula C30H28Cl2N2O4 and a molecular weight of 551.47 g/mol. Its IUPAC name is 4-[3-[3-[(E)-2-[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]ethenyl]-4-methoxyphenyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[3-[(E)-2-[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]ethenyl]-4-methoxyphenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 58211836 |
| Molecular Formula | C30H28Cl2N2O4 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-[3-[3-[(E)-2-[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]ethenyl]-4-methoxyphenyl]phenoxy]butanoic acid |
| SMILES | CCn1cc(-c2ccc(Cl)cc2Cl)nc1/C=C/c1cc(-c2cccc(OCCCC(=O)O)c2)ccc1OC |
| InChI | InChI=1S/C30H28Cl2N2O4/c1-3-34-19-27(25-12-11-23(31)18-26(25)32)33-29(34)14-10-22-16-21(9-13-28(22)37-2)20-6-4-7-24(17-20)38-15-5-8-30(35)36/h4,6-7,9-14,16-19H,3,5,8,15H2,1-2H3,(H,35,36)/b14-10+ |
| InChIKey | BTFKOPLJTYGTOP-GXDHUFHOSA-N |
| XLogP | 7.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|