C35H31Cl2N3O4 — CID 58211783
4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]butanoic acid (PubChem CID 58211783) has the molecular formula C35H31Cl2N3O4 and a molecular weight of 628.56 g/mol. Its IUPAC name is 4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 58211783 |
| Molecular Formula | C35H31Cl2N3O4 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]butanoic acid |
| SMILES | CC(NC(=O)Cn1cc(-c2ccc(Cl)cc2Cl)nc1/C=C/c1ccc(OCCCC(=O)O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C35H31Cl2N3O4/c1-23(28-9-4-7-25-6-2-3-8-29(25)28)38-34(41)22-40-21-32(30-17-14-26(36)20-31(30)37)39-33(40)18-13-24-11-15-27(16-12-24)44-19-5-10-35(42)43/h2-4,6-9,11-18,20-21,23H,5,10,19,22H2,1H3,(H,38,41)(H,42,43)/b18-13+ |
| InChIKey | LRWBFJNJPHEEDB-QGOAFFKASA-N |
| XLogP | 8.30 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|