C41H51N3O2 — CID 143116000
ethane;2-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-4-[(2E,4Z,7E)-7-methylnona-2,4,7-trien-3-yl]imidazol-1-yl]-N-(1-naphthalen-1-ylethyl)acetamide;prop-1-ene (PubChem CID 143116000) has the molecular formula C41H51N3O2 and a molecular weight of 617.88 g/mol. Its IUPAC name is ethane;2-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-4-[(2E,4Z,7E)-7-methylnona-2,4,7-trien-3-yl]imidazol-1-yl]-N-(1-naphthalen-1-ylethyl)acetamide;prop-1-ene.
| Compound Name | ethane;2-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-4-[(2E,4Z,7E)-7-methylnona-2,4,7-trien-3-yl]imidazol-1-yl]-N-(1-naphthalen-1-ylethyl)acetamide;prop-1-ene |
|---|---|
| PubChem CID | 143116000 |
| Molecular Formula | C41H51N3O2 |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | ethane;2-[2-[(E)-2-(4-methoxyphenyl)ethenyl]-4-[(2E,4Z,7E)-7-methylnona-2,4,7-trien-3-yl]imidazol-1-yl]-N-(1-naphthalen-1-ylethyl)acetamide;prop-1-ene |
| SMILES | C/C=C(\C)C/C=C\C(=C/C)c1cn(CC(=O)NC(C)c2cccc3ccccc23)c(/C=C/c2ccc(OC)cc2)n1.C=CC.CC |
| InChI | InChI=1S/C36H39N3O2.C3H6.C2H6/c1-6-26(3)12-10-14-29(7-2)34-24-39(35(38-34)23-20-28-18-21-31(41-5)22-19-28)25-36(40)37-27(4)32-17-11-15-30-13-8-9-16-33(30)32;1-3-2;1-2/h6-11,13-24,27H,12,25H2,1-5H3,(H,37,40);3H,1H2,2H3;1-2H3/b14-10-,23-20+,26-6+,29-7+;; |
| InChIKey | XLMAEGUJEOXCLG-YHQAHNMOSA-N |
| XLogP | 10.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|