C36H33Cl2N3O4 — CID 142933644
2-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(4-naphthalen-1-ylpentylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]acetic acid (PubChem CID 142933644) has the molecular formula C36H33Cl2N3O4 and a molecular weight of 642.58 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(4-naphthalen-1-ylpentylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(4-naphthalen-1-ylpentylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142933644 |
| Molecular Formula | C36H33Cl2N3O4 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | 2-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-[2-(4-naphthalen-1-ylpentylamino)-2-oxoethyl]imidazol-2-yl]ethenyl]phenoxy]acetic acid |
| SMILES | CC(CCCNC(=O)Cn1cc(-c2ccc(Cl)cc2Cl)nc1/C=C/c1ccc(OCC(=O)O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C36H33Cl2N3O4/c1-24(29-10-4-8-26-7-2-3-9-30(26)29)6-5-19-39-35(42)22-41-21-33(31-17-14-27(37)20-32(31)38)40-34(41)18-13-25-11-15-28(16-12-25)45-23-36(43)44/h2-4,7-18,20-21,24H,5-6,19,22-23H2,1H3,(H,39,42)(H,43,44)/b18-13+ |
| InChIKey | KRUKHNZOOZQXLY-QGOAFFKASA-N |
| XLogP | 8.34 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|