C36H29Cl2F3N2O3 — CID 67049193
methyl 4-[[4-(2,4-dichlorophenyl)-2-[2-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]benzoate (PubChem CID 67049193) has the molecular formula C36H29Cl2F3N2O3 and a molecular weight of 665.54 g/mol. Its IUPAC name is methyl 4-[[4-(2,4-dichlorophenyl)-2-[2-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(2,4-dichlorophenyl)-2-[2-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 67049193 |
| Molecular Formula | C36H29Cl2F3N2O3 |
| Molecular Weight | 665.54 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | methyl 4-[[4-(2,4-dichlorophenyl)-2-[2-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2cc(-c3ccc(Cl)cc3Cl)nc2C=Cc2ccc(-c3ccc(OCCCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H29Cl2F3N2O3/c1-45-35(44)28-10-5-25(6-11-28)22-43-23-33(31-17-14-29(37)21-32(31)38)42-34(43)18-7-24-3-8-26(9-4-24)27-12-15-30(16-13-27)46-20-2-19-36(39,40)41/h3-18,21,23H,2,19-20,22H2,1H3 |
| InChIKey | ZFTXBNKZVLNXEK-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.54 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|