C27H22Cl2N2O3 — CID 67049188
4-[2-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]-4-phenylphenoxy]butanoic acid (PubChem CID 67049188) has the molecular formula C27H22Cl2N2O3 and a molecular weight of 493.39 g/mol. Its IUPAC name is 4-[2-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]-4-phenylphenoxy]butanoic acid.
| Compound Name | 4-[2-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]-4-phenylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 67049188 |
| Molecular Formula | C27H22Cl2N2O3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-[2-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]-4-phenylphenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(-c2ccccc2)cc1C=Cc1ncc(-c2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C27H22Cl2N2O3/c28-21-10-11-22(23(29)16-21)24-17-30-26(31-24)13-9-20-15-19(18-5-2-1-3-6-18)8-12-25(20)34-14-4-7-27(32)33/h1-3,5-6,8-13,15-17H,4,7,14H2,(H,30,31)(H,32,33) |
| InChIKey | QPFMXWZMYBPTFT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|