C27H24Cl2N2O — CID 67049515
2-[2-[4-(4-butoxyphenyl)phenyl]ethenyl]-5-(2,4-dichlorophenyl)-1H-imidazole (PubChem CID 67049515) has the molecular formula C27H24Cl2N2O and a molecular weight of 463.41 g/mol. Its IUPAC name is 2-[2-[4-(4-butoxyphenyl)phenyl]ethenyl]-5-(2,4-dichlorophenyl)-1H-imidazole.
| Compound Name | 2-[2-[4-(4-butoxyphenyl)phenyl]ethenyl]-5-(2,4-dichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 67049515 |
| Molecular Formula | C27H24Cl2N2O |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[2-[4-(4-butoxyphenyl)phenyl]ethenyl]-5-(2,4-dichlorophenyl)-1H-imidazole |
| SMILES | CCCCOc1ccc(-c2ccc(C=Cc3ncc(-c4ccc(Cl)cc4Cl)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C27H24Cl2N2O/c1-2-3-16-32-23-12-9-21(10-13-23)20-7-4-19(5-8-20)6-15-27-30-18-26(31-27)24-14-11-22(28)17-25(24)29/h4-15,17-18H,2-3,16H2,1H3,(H,30,31) |
| InChIKey | OWTUBXXMIFPAGX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|