C31H29Cl2N3O4 — CID 67048987
4-[4-[4-[(E)-2-[5-[1-(2,4-dichlorophenyl)-2-(ethylamino)-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid (PubChem CID 67048987) has the molecular formula C31H29Cl2N3O4 and a molecular weight of 578.50 g/mol. Its IUPAC name is 4-[4-[4-[(E)-2-[5-[1-(2,4-dichlorophenyl)-2-(ethylamino)-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[4-[(E)-2-[5-[1-(2,4-dichlorophenyl)-2-(ethylamino)-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67048987 |
| Molecular Formula | C31H29Cl2N3O4 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 4-[4-[4-[(E)-2-[5-[1-(2,4-dichlorophenyl)-2-(ethylamino)-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
| SMILES | CCNC(=O)C(c1cnc(/C=C/c2ccc(-c3ccc(OCCCC(=O)O)cc3)cc2)[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H29Cl2N3O4/c1-2-34-31(39)30(25-15-12-23(32)18-26(25)33)27-19-35-28(36-27)16-7-20-5-8-21(9-6-20)22-10-13-24(14-11-22)40-17-3-4-29(37)38/h5-16,18-19,30H,2-4,17H2,1H3,(H,34,39)(H,35,36)(H,37,38)/b16-7+ |
| InChIKey | XXUMYKVOCJNXRL-FRKPEAEDSA-N |
| XLogP | 7.07 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|