C30H26Cl2N2O5 — CID 77251158
4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid (PubChem CID 77251158) has the molecular formula C30H26Cl2N2O5 and a molecular weight of 565.45 g/mol. Its IUPAC name is 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 77251158 |
| Molecular Formula | C30H26Cl2N2O5 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 4-[4-[3-[2-[5-[1-(2,4-dichlorophenyl)-2-methoxy-2-oxoethyl]-1H-imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
| SMILES | COC(=O)C(c1cnc(C=Cc2cccc(-c3ccc(OCCCC(=O)O)cc3)c2)[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H26Cl2N2O5/c1-38-30(37)29(24-13-10-22(31)17-25(24)32)26-18-33-27(34-26)14-7-19-4-2-5-21(16-19)20-8-11-23(12-9-20)39-15-3-6-28(35)36/h2,4-5,7-14,16-18,29H,3,6,15H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | KNPYJFSFSKXXHZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|