C18H17Cl2FO3 — CID 125465726
methyl (2S)-2-(2,4-dichlorophenyl)-5-(4-fluorophenoxy)pentanoate (PubChem CID 125465726) has the molecular formula C18H17Cl2FO3 and a molecular weight of 371.24 g/mol. Its IUPAC name is methyl (2S)-2-(2,4-dichlorophenyl)-5-(4-fluorophenoxy)pentanoate.
| Compound Name | methyl (2S)-2-(2,4-dichlorophenyl)-5-(4-fluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 125465726 |
| Molecular Formula | C18H17Cl2FO3 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | methyl (2S)-2-(2,4-dichlorophenyl)-5-(4-fluorophenoxy)pentanoate |
| SMILES | COC(=O)[C@@H](CCCOc1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2FO3/c1-23-18(22)16(15-9-4-12(19)11-17(15)20)3-2-10-24-14-7-5-13(21)6-8-14/h4-9,11,16H,2-3,10H2,1H3/t16-/m0/s1 |
| InChIKey | NQCWRMXRQOQAOM-INIZCTEOSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|