C17H15Cl2FO3 — CID 125465781
methyl (2R)-2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butanoate (PubChem CID 125465781) has the molecular formula C17H15Cl2FO3 and a molecular weight of 357.21 g/mol. Its IUPAC name is methyl (2R)-2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butanoate.
| Compound Name | methyl (2R)-2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butanoate |
|---|---|
| PubChem CID | 125465781 |
| Molecular Formula | C17H15Cl2FO3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl (2R)-2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butanoate |
| SMILES | COC(=O)[C@H](CCOc1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2FO3/c1-22-17(21)15(14-7-2-11(18)10-16(14)19)8-9-23-13-5-3-12(20)4-6-13/h2-7,10,15H,8-9H2,1H3/t15-/m1/s1 |
| InChIKey | WNBDRAIFXHJCFF-OAHLLOKOSA-N |
| XLogP | 4.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |