C20H24Cl2N2O3 — CID 51556512
(2S)-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methoxyphenoxy)ethylamino]propanamide (PubChem CID 51556512) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methoxyphenoxy)ethylamino]propanamide.
| Compound Name | (2S)-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methoxyphenoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 51556512 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2S)-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methoxyphenoxy)ethylamino]propanamide |
| SMILES | COc1ccc(OCCN[C@@H](C)C(=O)N[C@H](C)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H24Cl2N2O3/c1-13(18-9-4-15(21)12-19(18)22)24-20(25)14(2)23-10-11-27-17-7-5-16(26-3)6-8-17/h4-9,12-14,23H,10-11H2,1-3H3,(H,24,25)/t13-,14+/m1/s1 |
| InChIKey | BPLIUYUPSGGOIT-KGLIPLIRSA-N |
| XLogP | 4.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|