C17H18Cl2N2O4S — CID 24643135
N-[1-(2,4-dichlorophenyl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]acetamide (PubChem CID 24643135) has the molecular formula C17H18Cl2N2O4S and a molecular weight of 417.31 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 24643135 |
| Molecular Formula | C17H18Cl2N2O4S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NC(C)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O4S/c1-11(15-8-3-12(18)9-16(15)19)21-17(22)10-20-26(23,24)14-6-4-13(25-2)5-7-14/h3-9,11,20H,10H2,1-2H3,(H,21,22) |
| InChIKey | GMVHQZYBXOMXDV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |