C16H14Cl3NO3S — CID 24559842
2-(4-chlorophenyl)sulfonyl-N-[1-(2,4-dichlorophenyl)ethyl]acetamide (PubChem CID 24559842) has the molecular formula C16H14Cl3NO3S and a molecular weight of 406.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[1-(2,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[1-(2,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 24559842 |
| Molecular Formula | C16H14Cl3NO3S |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[1-(2,4-dichlorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CS(=O)(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3NO3S/c1-10(14-7-4-12(18)8-15(14)19)20-16(21)9-24(22,23)13-5-2-11(17)3-6-13/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | JLJIYOXWWOMMBT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |