C16H15Cl2NO3S — CID 9441444
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-4-methylsulfonylbenzamide (PubChem CID 9441444) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 9441444 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-4-methylsulfonylbenzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(S(C)(=O)=O)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-10(14-8-5-12(17)9-15(14)18)19-16(20)11-3-6-13(7-4-11)23(2,21)22/h3-10H,1-2H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | LCHAOEDESDMERA-SNVBAGLBSA-N |
| XLogP | 3.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |