C19H18Cl2N2O3S — CID 177140120
6-chloro-N-[1-(2-chloro-4-methylsulfonylphenyl)ethyl]-1-methylindole-2-carboxamide (PubChem CID 177140120) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is 6-chloro-N-[1-(2-chloro-4-methylsulfonylphenyl)ethyl]-1-methylindole-2-carboxamide.
| Compound Name | 6-chloro-N-[1-(2-chloro-4-methylsulfonylphenyl)ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 177140120 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 6-chloro-N-[1-(2-chloro-4-methylsulfonylphenyl)ethyl]-1-methylindole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccc(Cl)cc2n1C)c1ccc(S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O3S/c1-11(15-7-6-14(10-16(15)21)27(3,25)26)22-19(24)18-8-12-4-5-13(20)9-17(12)23(18)2/h4-11H,1-3H3,(H,22,24) |
| InChIKey | AMDWMFCZIAECKV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |