C20H21ClN4O — CID 177139948
6-chloro-N-[1-[3-methanimidoyl-4-(methylamino)phenyl]ethyl]-1-methylindole-2-carboxamide (PubChem CID 177139948) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 6-chloro-N-[1-[3-methanimidoyl-4-(methylamino)phenyl]ethyl]-1-methylindole-2-carboxamide.
| Compound Name | 6-chloro-N-[1-[3-methanimidoyl-4-(methylamino)phenyl]ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 177139948 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 6-chloro-N-[1-[3-methanimidoyl-4-(methylamino)phenyl]ethyl]-1-methylindole-2-carboxamide |
| SMILES | [H]/N=C/c1cc(C(C)NC(=O)c2cc3ccc(Cl)cc3n2C)ccc1NC |
| InChI | InChI=1S/C20H21ClN4O/c1-12(13-5-7-17(23-2)15(8-13)11-22)24-20(26)19-9-14-4-6-16(21)10-18(14)25(19)3/h4-12,22-23H,1-3H3,(H,24,26)/b22-11+ |
| InChIKey | QWVDKSZTJMAIQF-SSDVNMTOSA-N |
| XLogP | 4.36 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|