C19H22Cl2N4OS — CID 177140289
N-[1-(6-aminosulfanyl-5-chloro-3-pyridinyl)ethyl]-6-chloro-1-methylindole-2-carboxamide;ethane (PubChem CID 177140289) has the molecular formula C19H22Cl2N4OS and a molecular weight of 425.39 g/mol. Its IUPAC name is N-[1-(6-aminosulfanyl-5-chloro-3-pyridinyl)ethyl]-6-chloro-1-methylindole-2-carboxamide;ethane.
| Compound Name | N-[1-(6-aminosulfanyl-5-chloro-3-pyridinyl)ethyl]-6-chloro-1-methylindole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 177140289 |
| Molecular Formula | C19H22Cl2N4OS |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[1-(6-aminosulfanyl-5-chloro-3-pyridinyl)ethyl]-6-chloro-1-methylindole-2-carboxamide;ethane |
| SMILES | CC.CC(NC(=O)c1cc2ccc(Cl)cc2n1C)c1cnc(SN)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N4OS.C2H6/c1-9(11-5-13(19)17(25-20)21-8-11)22-16(24)15-6-10-3-4-12(18)7-14(10)23(15)2;1-2/h3-9H,20H2,1-2H3,(H,22,24);1-2H3 |
| InChIKey | BCCVGUKWIAMJOA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|