C20H23N3O3S — CID 177140188
1,6-dimethyl-N-[1-[4-(methylsulfamoyl)phenyl]ethyl]indole-2-carboxamide (PubChem CID 177140188) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1,6-dimethyl-N-[1-[4-(methylsulfamoyl)phenyl]ethyl]indole-2-carboxamide.
| Compound Name | 1,6-dimethyl-N-[1-[4-(methylsulfamoyl)phenyl]ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 177140188 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1,6-dimethyl-N-[1-[4-(methylsulfamoyl)phenyl]ethyl]indole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(C)NC(=O)c2cc3ccc(C)cc3n2C)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-13-5-6-16-12-19(23(4)18(16)11-13)20(24)22-14(2)15-7-9-17(10-8-15)27(25,26)21-3/h5-12,14,21H,1-4H3,(H,22,24) |
| InChIKey | ITMFNXHSWQTBHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |