C20H22ClN3O2 — CID 177140163
6-chloro-N-[1-[5-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-1-methylindole-2-carboxamide (PubChem CID 177140163) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 6-chloro-N-[1-[5-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-1-methylindole-2-carboxamide.
| Compound Name | 6-chloro-N-[1-[5-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 177140163 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 6-chloro-N-[1-[5-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-1-methylindole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccc(Cl)cc2n1C)c1ccc(C(C)(C)O)cn1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-12(16-8-6-14(11-22-16)20(2,3)26)23-19(25)18-9-13-5-7-15(21)10-17(13)24(18)4/h5-12,26H,1-4H3,(H,23,25) |
| InChIKey | HIRWEQGPUKVAMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |