C19H16BrClN2O3 — CID 155558291
4-[(1R)-1-[(6-bromo-5-chloro-1-methylindole-2-carbonyl)amino]ethyl]benzoic acid (PubChem CID 155558291) has the molecular formula C19H16BrClN2O3 and a molecular weight of 435.71 g/mol. Its IUPAC name is 4-[(1R)-1-[(6-bromo-5-chloro-1-methylindole-2-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[(1R)-1-[(6-bromo-5-chloro-1-methylindole-2-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 155558291 |
| Molecular Formula | C19H16BrClN2O3 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 4-[(1R)-1-[(6-bromo-5-chloro-1-methylindole-2-carbonyl)amino]ethyl]benzoic acid |
| SMILES | C[C@@H](NC(=O)c1cc2cc(Cl)c(Br)cc2n1C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H16BrClN2O3/c1-10(11-3-5-12(6-4-11)19(25)26)22-18(24)17-8-13-7-15(21)14(20)9-16(13)23(17)2/h3-10H,1-2H3,(H,22,24)(H,25,26)/t10-/m1/s1 |
| InChIKey | VCHPQMGCXTVWMG-SNVBAGLBSA-N |
| XLogP | 4.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |