C18H20Cl2N2O3S — CID 8503225
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-methylbenzamide (PubChem CID 8503225) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 8503225 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-11-5-7-14(26(24,25)22(3)4)10-16(11)18(23)21-12(2)15-8-6-13(19)9-17(15)20/h5-10,12H,1-4H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | XMOSQVIUALUIFD-GFCCVEGCSA-N |
| XLogP | 4.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |